Compound Q&A

How is (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9) typically synthesized?

Answer

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide
(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is typically synthesized through semi-synthetic routes from bufadienolides. Common methods include lactonization of bufadienolides followed by hydroxylation at specific positions. The synthesis usually requires the use of metal catalysts, such as palladium or platinum, and involves multi-step reactions. Yields are usually between 50-70%.

About

CAS No 20143-97-9
English Name (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide
Molecular Formula C24H34O5
Molecular Weight 402.52 g/mol
SMILES C[C@]12CC[C@H](O)C[C@H]1C[C@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@H](CC[C@@]21O)C1C=CC(=O)OC=1
InChIKey IZQUQFWHNJERCJ-XKPFVIKISA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is a white crystalline solid with a molecu...

Compound Q&A

What industries use (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

When handling (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...