Compound Q&A

What are the physical and chemical properties of (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

Answer

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide
(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is a white crystalline solid with a molecular weight of approximately 428.44 g/mol. It is sparingly soluble in water and ethanol, and soluble in methanol. Chemically, it is highly reactive, especially with bases and reducing agents. Its stability is moderate, but it should be stored in a dry, cool place away from direct sunlight and strong acids.

About

CAS No 20143-97-9
English Name (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide
Molecular Formula C24H34O5
Molecular Weight 402.52 g/mol
SMILES C[C@]12CC[C@H](O)C[C@H]1C[C@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@H](CC[C@@]21O)C1C=CC(=O)OC=1
InChIKey IZQUQFWHNJERCJ-XKPFVIKISA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

How is (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9) typically synthesized?

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is typically synthesized through semi-synt...

Compound Q&A

What industries use (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is primarily used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

When handling (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...