Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

Answer

3',5'-Di-O-benzoyl Fialuridine
When handling 3',5'-Di-O-benzoyl Fialuridine, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be stored in a cool, dry place away from direct sunlight and moisture. Fume hoods should be used during synthesis to minimize exposure to volatile organic compounds. Always consult the Safety Data Sheet (SDS) for detailed handling and disposal instructions.

About

CAS No 97614-45-4
English Name 3',5'-Di-O-benzoyl Fialuridine
Molecular Formula C23H18FIN2O7
Molecular Weight 580.31 g/mol
SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=C(C(=O)NC3=O)I)F)OC(=O)C4=CC=CC=C4
InChIKey FBENGCVQLDKVAT-AJYBTWMASA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

3',5'-Di-O-benzoyl Fialuridine is a crystalline compound with a molecular weight of approximately 54...

Compound Q&A

How is 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4) typically synthesized?

3',5'-Di-O-benzoyl Fialuridine is typically synthesized through the benzoylation of fialuridine usin...

Compound Q&A

What industries use 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

3',5'-Di-O-benzoyl Fialuridine is primarily used in the pharmaceutical industry as an intermediate f...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...