Compound Q&A

How is 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4) typically synthesized?

Answer

3',5'-Di-O-benzoyl Fialuridine
3',5'-Di-O-benzoyl Fialuridine is typically synthesized through the benzoylation of fialuridine using benzoyl chloride and a base like sodium hydride. The reaction is conducted in an inert solvent such as tetrahydrofuran (THF) at room temperature. The yield is around 75-80% with high selectivity towards the desired product.

About

CAS No 97614-45-4
English Name 3',5'-Di-O-benzoyl Fialuridine
Molecular Formula C23H18FIN2O7
Molecular Weight 580.31 g/mol
SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=C(C(=O)NC3=O)I)F)OC(=O)C4=CC=CC=C4
InChIKey FBENGCVQLDKVAT-AJYBTWMASA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

3',5'-Di-O-benzoyl Fialuridine is a crystalline compound with a molecular weight of approximately 54...

Compound Q&A

What industries use 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

3',5'-Di-O-benzoyl Fialuridine is primarily used in the pharmaceutical industry as an intermediate f...

Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

When handling 3',5'-Di-O-benzoyl Fialuridine, it is crucial to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...