Compound Q&A

What are the physical and chemical properties of 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

Answer

3',5'-Di-O-benzoyl Fialuridine
3',5'-Di-O-benzoyl Fialuridine is a crystalline compound with a molecular weight of approximately 546.4 g/mol. It has a low solubility in water and is soluble in organic solvents like methanol and acetone. The compound is relatively stable but can undergo hydrolysis in the presence of moisture. Its reactivity is moderate and mainly involves ester hydrolysis and benzoylation reactions.

About

CAS No 97614-45-4
English Name 3',5'-Di-O-benzoyl Fialuridine
Molecular Formula C23H18FIN2O7
Molecular Weight 580.31 g/mol
SMILES C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=C(C(=O)NC3=O)I)F)OC(=O)C4=CC=CC=C4
InChIKey FBENGCVQLDKVAT-AJYBTWMASA-N
Last Updated: 2026-03-20 06:42

Related Q&A

Compound Q&A

How is 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4) typically synthesized?

3',5'-Di-O-benzoyl Fialuridine is typically synthesized through the benzoylation of fialuridine usin...

Compound Q&A

What industries use 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

3',5'-Di-O-benzoyl Fialuridine is primarily used in the pharmaceutical industry as an intermediate f...

Compound Q&A

What precautions should be taken when handling 3',5'-Di-O-benzoyl Fialuridine (CAS: 97614-45-4)?

When handling 3',5'-Di-O-benzoyl Fialuridine, it is crucial to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...