Compound Q&A

What industries use (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6)?

Answer

(2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide
This compound is primarily used in the pharmaceutical industry for its potential as a bioactive molecule. It may also find applications in the development of new materials, particularly in the area of sensors due to its chemical reactivity. Additionally, it could be relevant in the field of semiconductors for its unique electronic properties.

About

CAS No 50587-95-6
English Name (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide
Molecular Formula C32H55BrN2O3
Molecular Weight 595.7 g/mol
SMILES CC(=O)OC1CC2CCC3C(C2(CC1N4CCCCC4)C)CCC5(C3CC(C5O)[N+]6(CCCCC6)C)C.[Br-]
InChIKey XPLMFSDSQRHLDG-FMCCZJBLSA-M
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6) typically synthesized?

This compound is synthesized through a multi-step process involving the functionalization of a stero...

Compound Q&A

What is Ethyl 3-cyclohexylpropanoate (CAS: 10094-36-7)?

Ethyl 3-cyclohexylpropanoate is a clear, colorless to light yellow liquid with a...

10094-36-7Ethyl 3-cyclohexylpr...
Compound Q&A

How should waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl)nicotinic acid (CAS: 34783-31-8) be handled?

Waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl...

34783-31-82-(Hydroxymethyl)-5-...
Compound Q&A

How should waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) be handled?

Waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) sho...

858-46-82,4,6-Tris(pentafluo...
Compound Q&A

What precautions should be taken when handling Chloroac-nle-oh (CAS: 56787-36-1)?

When handling Chloroac-nle-oh (CAS: 56787-36-1), it is essential to wear appropr...

56787-36-1Chloroac-nle-oh