Compound Q&A

How is (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6) typically synthesized?

Answer

(2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide
This compound is synthesized through a multi-step process involving the functionalization of a steroidal backbone. The synthesis typically begins with the introduction of an acetoxy group followed by the installation of the piperidinium and piperidine substituents. The bromide is then introduced using a suitable brominating agent. The overall process involves the use of organic solvents and reagents, with careful control of reaction conditions to achieve high yield and selectivity.

About

CAS No 50587-95-6
English Name (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide
Molecular Formula C32H55BrN2O3
Molecular Weight 595.7 g/mol
SMILES CC(=O)OC1CC2CCC3C(C2(CC1N4CCCCC4)C)CCC5(C3CC(C5O)[N+]6(CCCCC6)C)C.[Br-]
InChIKey XPLMFSDSQRHLDG-FMCCZJBLSA-M
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What industries use (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive mole...

Compound Q&A

What is Ethyl 3-cyclohexylpropanoate (CAS: 10094-36-7)?

Ethyl 3-cyclohexylpropanoate is a clear, colorless to light yellow liquid with a...

10094-36-7Ethyl 3-cyclohexylpr...
Compound Q&A

How should waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl)nicotinic acid (CAS: 34783-31-8) be handled?

Waste containing 2-(Hydroxymethyl)-5-(methoxycarbonyl)-6-methyl-4-(2-nitrophenyl...

34783-31-82-(Hydroxymethyl)-5-...
Compound Q&A

How should waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) be handled?

Waste containing 2,4,6-Tris(pentafluoroethyl)-1,3,5-triazine (CAS: 858-46-8) sho...

858-46-82,4,6-Tris(pentafluo...
Compound Q&A

What precautions should be taken when handling Chloroac-nle-oh (CAS: 56787-36-1)?

When handling Chloroac-nle-oh (CAS: 56787-36-1), it is essential to wear appropr...

56787-36-1Chloroac-nle-oh