Compound Q&A

What are the physical and chemical properties of (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6)?

Answer

(2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide
This compound is a steroidal derivative with a molecular weight of approximately 646.5 g/mol. It crystallizes in a hexagonal form with a melting point around 230-235°C. The compound is poorly soluble in water but soluble in organic solvents like methanol and acetone. It is reactive towards basic conditions and susceptible to hydrolysis under acidic conditions. The compound is not volatile and does not have a strong odor.

About

CAS No 50587-95-6
English Name (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide
Molecular Formula C32H55BrN2O3
Molecular Weight 595.7 g/mol
SMILES CC(=O)OC1CC2CCC3C(C2(CC1N4CCCCC4)C)CCC5(C3CC(C5O)[N+]6(CCCCC6)C)C.[Br-]
InChIKey XPLMFSDSQRHLDG-FMCCZJBLSA-M
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6) typically synthesized?

This compound is synthesized through a multi-step process involving the functionalization of a stero...

Compound Q&A

What industries use (2beta,3alpha,5alpha,16beta,17beta)-3-Acetoxy-17-hydroxy-16-(1-methyl-1-piperidiniumyl)-2-(1-piperidinyl)androstane bromide (CAS: 50587-95-6)?

This compound is primarily used in the pharmaceutical industry for its potential as a bioactive mole...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...