Compound Q&A

What industries use 3-Amino-3-(3-hydroxyphenyl)propanoic acid (CAS: 102872-33-3)?

Answer

3-Amino-3-(3-hydroxyphenyl)propanoic acid
3-Amino-3-(3-hydroxyphenyl)propanoic acid finds application in the pharmaceutical industry as an intermediate in the synthesis of various bioactive compounds. It is also used in the production of polymers for biomedical applications and in the development of sensors due to its chemical reactivity and structural characteristics.

About

English Name 3-Amino-3-(3-hydroxyphenyl)propanoic acid
Molecular Formula C9H11NO3
Molecular Weight 181.19 g/mol
SMILES C1=CC(=CC(=C1)O)C(CC(=O)O)N
InChIKey NYHNEKBZZXSUNO-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Amino-3-(3-hydroxyphenyl)propanoic acid (CAS: 102872-33-3)?

3-Amino-3-(3-hydroxyphenyl)propanoic acid is a solid crystalline compound with a molecular weight of...

Compound Q&A

How is 3-Amino-3-(3-hydroxyphenyl)propanoic acid (CAS: 102872-33-3) typically synthesized?

3-Amino-3-(3-hydroxyphenyl)propanoic acid is typically synthesized via the Claisen condensation betw...

Compound Q&A

What precautions should be taken when handling 3-Amino-3-(3-hydroxyphenyl)propanoic acid (CAS: 102872-33-3)?

When handling 3-Amino-3-(3-hydroxyphenyl)propanoic acid, it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...