Compound Q&A

What industries use 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

Answer

4-Ethoxy-3-nitrobenzoic acid
4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) finds applications in the pharmaceutical industry, where it serves as a precursor for the synthesis of various medicinal compounds. It is also used in the production of organic sensors and in the synthesis of certain polymer materials. Additionally, it may be employed in the semiconductor industry for specific chemical processes.

About

CAS No 59719-77-6
English Name 4-Ethoxy-3-nitrobenzoic acid
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES CCOC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey GZHXYRWGRKIXEJ-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) is a crystalline solid at room temperature with a mol...

Compound Q&A

How is 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) typically synthesized?

4-Ethoxy-3-nitrobenzoic acid can be synthesized by the nitration of 4-ethoxybenzoic acid followed by...

Compound Q&A

What precautions should be taken when handling 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

When handling 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6), safety goggles, laboratory coat, and g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...