Compound Q&A

What are the physical and chemical properties of 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

Answer

4-Ethoxy-3-nitrobenzoic acid
4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) is a crystalline solid at room temperature with a molecular weight of approximately 222.18 g/mol. It has a high solubility in organic solvents like ethanol and acetone, but is only slightly soluble in water. This compound is moderately reactive, particularly towards nucleophilic substitution and reduction reactions. It has a pKa value of around 4, indicating it is a weak acid.

About

CAS No 59719-77-6
English Name 4-Ethoxy-3-nitrobenzoic acid
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES CCOC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey GZHXYRWGRKIXEJ-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

How is 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) typically synthesized?

4-Ethoxy-3-nitrobenzoic acid can be synthesized by the nitration of 4-ethoxybenzoic acid followed by...

Compound Q&A

What industries use 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) finds applications in the pharmaceutical industry, wh...

Compound Q&A

What precautions should be taken when handling 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

When handling 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6), safety goggles, laboratory coat, and g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...