Compound Q&A

How is 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) typically synthesized?

Answer

4-Ethoxy-3-nitrobenzoic acid
4-Ethoxy-3-nitrobenzoic acid can be synthesized by the nitration of 4-ethoxybenzoic acid followed by hydrolysis. Commonly, this involves reacting 4-ethoxybenzoic acid with a nitration mixture of concentrated sulfuric acid and fuming nitric acid. The reaction is typically carried out in an ice bath to control the temperature, and the yield can be up to 75%. This process requires strict monitoring to ensure selectivity and safety.

About

CAS No 59719-77-6
English Name 4-Ethoxy-3-nitrobenzoic acid
Molecular Formula C9H9NO5
Molecular Weight 211.17 g/mol
SMILES CCOC1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-]
InChIKey GZHXYRWGRKIXEJ-UHFFFAOYSA-N
Last Updated: 2026-03-20 02:47

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) is a crystalline solid at room temperature with a mol...

Compound Q&A

What industries use 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6) finds applications in the pharmaceutical industry, wh...

Compound Q&A

What precautions should be taken when handling 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6)?

When handling 4-Ethoxy-3-nitrobenzoic acid (CAS: 59719-77-6), safety goggles, laboratory coat, and g...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...