Compound Q&A

What precautions should be taken when handling 3-(Trifluoromethoxy)benzohydrazide (CAS: 321195-88-4)?

Answer

3-(Trifluoromethoxy)benzohydrazide
Proper handling of 3-(Trifluoromethoxy)benzohydrazide requires the use of appropriate Personal Protective Equipment (PPE), including gloves, safety goggles, and laboratory coat. Handling should be done in a well-ventilated area or a fume hood to prevent inhalation of fumes. Spills should be cleaned up immediately using absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling and disposal information.

About

English Name 3-(Trifluoromethoxy)benzohydrazide
Molecular Formula C8H7F3N2O2
Molecular Weight 220.15 g/mol
SMILES C1=CC(=CC(=C1)OC(F)(F)F)C(=O)NN
InChIKey MNEXCWJCDZXJLF-UHFFFAOYSA-N
Last Updated: 2026-03-19 20:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Trifluoromethoxy)benzohydrazide (CAS: 321195-88-4)?

3-(Trifluoromethoxy)benzohydrazide is a white crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 3-(Trifluoromethoxy)benzohydrazide (CAS: 321195-88-4) typically synthesized?

3-(Trifluoromethoxy)benzohydrazide is typically synthesized through the condensation reaction betwee...

Compound Q&A

What industries use 3-(Trifluoromethoxy)benzohydrazide (CAS: 321195-88-4)?

3-(Trifluoromethoxy)benzohydrazide is used in various industries, particularly in pharmaceuticals fo...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...