Compound Q&A

What are the physical and chemical properties of (S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine (CAS: 773127-33-6)?

Answer

(S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine
(S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine is a white crystalline solid with a molecular weight of approximately 256.08 g/mol. It has a low water solubility and is highly soluble in organic solvents like dichloromethane and chloroform. This compound is relatively unreactive but can undergo nucleophilic substitution reactions. It exhibits good stability under normal conditions but should be stored in a tightly sealed container away from moisture and heat.

About

English Name (S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine
Molecular Formula C9H10F3NO
Molecular Weight 205.18 g/mol
SMILES COC1=CC=C(C=C1)C(C(F)(F)F)N
InChIKey WXWSEEIYIQOYNZ-QMMMGPOBSA-N
Last Updated: 2026-03-19 14:17

Related Q&A

Compound Q&A

How is (S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine (CAS: 773127-33-6) typically synthesized?

(S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine is typically synthesized by the reduction of tr...

Compound Q&A

What industries use (S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine (CAS: 773127-33-6)?

(S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine is primarily used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling (S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine (CAS: 773127-33-6)?

When handling (S)-2,2,2-trifluoro-1-(4-methoxyphenyl)ethan-1-amine, it is essential to wear appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...