Compound Q&A

Is 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3) safe?

Answer

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid
1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is generally safe when handled with proper precautions. However, it is corrosive and can irritate the skin and eyes. Proper personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Avoid ingestion and direct contact with the compound.

About

English Name 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid
Molecular Formula C6H7NO4S
Molecular Weight 189.19 g/mol
SMILES CS(=O)(=O)n1ccc(c1)C(=O)O
InChIKey KGRVXGKPSGKBPR-UHFFFAOYSA-N
Last Updated: 2026-03-18 22:39

Related Q&A

Compound Q&A

What is 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3)?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is a chemical compound with the CAS number 1521806-4...

Compound Q&A

What are the main uses of 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3)?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is primarily used in pharmaceutical research for the...

Compound Q&A

How should 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3) be stored?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...