Compound Q&A

What is 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3)?

Answer

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid
1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is a chemical compound with the CAS number 1521806-48-3. It is a colorless solid with a molecular formula of C6H6NO3S and a pungent odor. This compound is characterized by its acidic properties and can be used in research and pharmaceutical applications.

About

English Name 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid
Molecular Formula C6H7NO4S
Molecular Weight 189.19 g/mol
SMILES CS(=O)(=O)n1ccc(c1)C(=O)O
InChIKey KGRVXGKPSGKBPR-UHFFFAOYSA-N
Last Updated: 2026-03-18 22:39

Related Q&A

Compound Q&A

What are the main uses of 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3)?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is primarily used in pharmaceutical research for the...

Compound Q&A

Is 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3) safe?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is generally safe when handled with proper precautio...

Compound Q&A

How should 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3) be stored?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...