Compound Q&A

What are the main uses of 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3)?

Answer

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid
1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is primarily used in pharmaceutical research for the synthesis of drug candidates. It may also find applications in organic synthesis due to its unique functional groups, such as the methylsulfonyl and carboxylic acid moieties, which are valuable in various chemical transformations.

About

English Name 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid
Molecular Formula C6H7NO4S
Molecular Weight 189.19 g/mol
SMILES CS(=O)(=O)n1ccc(c1)C(=O)O
InChIKey KGRVXGKPSGKBPR-UHFFFAOYSA-N
Last Updated: 2026-03-18 22:39

Related Q&A

Compound Q&A

What is 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3)?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is a chemical compound with the CAS number 1521806-4...

Compound Q&A

Is 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3) safe?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid is generally safe when handled with proper precautio...

Compound Q&A

How should 1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid (CAS: 1521806-48-3) be stored?

1-(Methylsulfonyl)-1H-pyrrole-3-carboxylic acid should be stored in a cool, dry place away from dire...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...