Compound Q&A

How is Kanamycin Sulfate (CAS: 133-92-6) typically synthesized?

Answer

Kanamycin Sulfate
Kanamycin Sulfate is synthesized by a fermentation process followed by chemical modification. The fermentation involves the growth of Streptomyces kanamyceticus, which produces the primary kanamycin compound. This is then converted to kanamycin sulfate through a sulfate esterification process. The synthesis typically requires careful control of pH and temperature to achieve high yield and selectivity.

About

CAS No 133-92-6
English Name Kanamycin Sulfate
Molecular Formula C18H38N4O15S
Molecular Weight 582.6 g/mol
SMILES C1C(C(C(C(C1N)OC2C(C(C(C(O2)CN)O)O)O)O)OC3C(C(C(C(O3)CO)O)N)O)N.OS(=O)(=O)O
InChIKey OOYGSFOGFJDDHP-KMCOLRRFSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Kanamycin Sulfate (CAS: 133-92-6)?

Kanamycin Sulfate is a white to off-white crystalline powder with a molecular weight of approximatel...

Compound Q&A

What industries use Kanamycin Sulfate (CAS: 133-92-6)?

Kanamycin Sulfate is primarily used in the pharmaceutical industry for its antibiotic properties. It...

Compound Q&A

What precautions should be taken when handling Kanamycin Sulfate (CAS: 133-92-6)?

When handling Kanamycin Sulfate, it is important to wear appropriate personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...