Compound Q&A

How is Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2) typically synthesized?

Answer

Methyl 5-nitro-2-(1-piperazinyl)benzoate
Methyl 5-nitro-2-(1-piperazinyl)benzoate is typically synthesized through a multi-step process involving the condensation of 2-nitrobenzoic acid with piperazine followed by methylation. Common solvents used include acetic anhydride, and the reaction is often catalyzed by concentrated sulfuric acid. The yield is generally around 70-80%, with high selectivity for the desired product.

About

English Name Methyl 5-nitro-2-(1-piperazinyl)benzoate
Molecular Formula C12H15N3O4
Molecular Weight 265.26 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N2CCNCC2
InChIKey PYZUYRBYEKFTPS-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2)?

Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2) is a crystalline solid with a molecular ...

Compound Q&A

What industries use Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2)?

Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2)?

When handling Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...