Compound Q&A

What are the physical and chemical properties of Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2)?

Answer

Methyl 5-nitro-2-(1-piperazinyl)benzoate
Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2) is a crystalline solid with a molecular weight of approximately 296.16 g/mol. It has a solubility of about 1.5 g/L in water and is slightly soluble in ethanol. The compound is moderately reactive towards acids and bases. It is stable under standard storage conditions but should be protected from moisture and light.

About

English Name Methyl 5-nitro-2-(1-piperazinyl)benzoate
Molecular Formula C12H15N3O4
Molecular Weight 265.26 g/mol
SMILES COC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])N2CCNCC2
InChIKey PYZUYRBYEKFTPS-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

How is Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2) typically synthesized?

Methyl 5-nitro-2-(1-piperazinyl)benzoate is typically synthesized through a multi-step process invol...

Compound Q&A

What industries use Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2)?

Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2) is primarily used in the pharmaceutical ...

Compound Q&A

What precautions should be taken when handling Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2)?

When handling Methyl 5-nitro-2-(1-piperazinyl)benzoate (CAS: 886360-73-2), it is essential to wear a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...