Compound Q&A

What precautions should be taken when handling 4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3)?

Answer

4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide
When handling 4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to potential vapors. Spills should be cleaned up with caution, using appropriate absorbents, and followed by thorough cleaning with water. Always consult the Material Safety Data Sheet (MSDS) or Safety Data Sheet (SDS) for detailed information and emergency procedures.

About

CAS No 8013-10-3
English Name 4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide
Molecular Formula C9H9BrFNO2
Molecular Weight 262.08 g/mol
SMILES BrC1C=CC(=C(C=1)F)C(N(C)OC)=O
InChIKey GDYDISRVUKFNSH-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3)?

4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3) is a crystalline solid with a molecula...

Compound Q&A

How is 4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3) typically synthesized?

4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3) is typically synthesized through a mul...

Compound Q&A

What industries use 4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3)?

4-Bromo-2-fluoro-N-methoxy-N-methylbenzamide (CAS: 8013-10-3) is used in various industries, particu...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...