Compound Q&A

What industries use 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

Answer

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) is primarily used in the pharmaceutical industry for the synthesis of various bioactive compounds, particularly in the development of anti-inflammatory and antiviral drugs. It also finds applications in the chemical industry, where it is used as a precursor for the production of other organic compounds and in the development of new materials.

About

CAS No 76824-93-6
English Name 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES COC1=C(C=C2CNC(CC2=C1)C(=O)O)O
InChIKey WBDSVFTUSBMMLD-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) is a crystall...

Compound Q&A

How is 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) typically synthesized?

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid can be synthesized through a mu...

Compound Q&A

What precautions should be taken when handling 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

When handling 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...