Compound Q&A

What are the physical and chemical properties of 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

Answer

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) is a crystalline solid with a molecular weight of approximately 241.26 g/mol. It has a pKa value around 4.0 and is slightly soluble in water. The compound is known for its reactivity towards nucleophiles and its stability under neutral conditions. It can form salts with acids and bases, and it has good solubility in organic solvents such as methanol and ethanol.

About

CAS No 76824-93-6
English Name 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES COC1=C(C=C2CNC(CC2=C1)C(=O)O)O
InChIKey WBDSVFTUSBMMLD-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

How is 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) typically synthesized?

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid can be synthesized through a mu...

Compound Q&A

What industries use 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) is primarily ...

Compound Q&A

What precautions should be taken when handling 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

When handling 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...