Compound Q&A

How is 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) typically synthesized?

Answer

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid can be synthesized through a multistep process involving the protection of an alcohol group, followed by an acylation reaction, and subsequent deprotection. Commonly used reagents include methoxyamine hydrochloride, acetic anhydride, and sodium hydroxide. The yield is usually around 70-80%, and the reaction is typically carried out under mild conditions to achieve high selectivity.

About

CAS No 76824-93-6
English Name 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid
Molecular Formula C11H13NO4
Molecular Weight 223.23 g/mol
SMILES COC1=C(C=C2CNC(CC2=C1)C(=O)O)O
InChIKey WBDSVFTUSBMMLD-UHFFFAOYSA-N
Last Updated: 2026-03-17 15:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) is a crystall...

Compound Q&A

What industries use 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6) is primarily ...

Compound Q&A

What precautions should be taken when handling 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)?

When handling 7-Hydroxy-6-methoxy-1,2,3,4-tetrahydro-3-isoquinolinecarboxylic acid (CAS: 76824-93-6)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...