Compound Q&A

What precautions should be taken when handling 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

Answer

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride
When handling 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride, it is important to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. Ensure that the compound is used in a well-ventilated area or a fume hood to avoid inhalation of any fumes. Spills should be cleaned up with caution, using appropriate absorbents, and the area should be well-ventilated. Refer to the safety data sheet (SDS) for detailed handling and disposal information to maintain workplace safety.

About

CAS No 70862-65-6
English Name 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride
Molecular Formula C24H47ClN2
Molecular Weight 399.1 g/mol
SMILES CCCCCCCCCCN1C=C[N+](=C1C)CCCCCCCCCC.[Cl-]
InChIKey GJYWPRKIEORZLX-UHFFFAOYSA-M
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight...

Compound Q&A

How is 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6) typically synthesized?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride is typically synthesized through a multi-step proces...

Compound Q&A

What industries use 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride finds applications in various industries, including ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...