Compound Q&A

What are the physical and chemical properties of 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

Answer

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride
1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight of approximately 428.5 g/mol. It has a low melting point and is soluble in common organic solvents. This compound is known for its mild reactivity with acidic and basic substances. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight to preserve its properties.

About

CAS No 70862-65-6
English Name 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride
Molecular Formula C24H47ClN2
Molecular Weight 399.1 g/mol
SMILES CCCCCCCCCCN1C=C[N+](=C1C)CCCCCCCCCC.[Cl-]
InChIKey GJYWPRKIEORZLX-UHFFFAOYSA-M
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6) typically synthesized?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride is typically synthesized through a multi-step proces...

Compound Q&A

What industries use 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride finds applications in various industries, including ...

Compound Q&A

What precautions should be taken when handling 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

When handling 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...