Compound Q&A

What industries use 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

Answer

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride
1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride finds applications in various industries, including pharmaceuticals, where it serves as an ion exchange material, and in the field of sensors for its unique chemical reactivity. It is also used in polymer synthesis and as a component in certain semiconductors. Its properties make it suitable for laboratory and industrial processes requiring specific ion exchange or sensing capabilities.

About

CAS No 70862-65-6
English Name 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride
Molecular Formula C24H47ClN2
Molecular Weight 399.1 g/mol
SMILES CCCCCCCCCCN1C=C[N+](=C1C)CCCCCCCCCC.[Cl-]
InChIKey GJYWPRKIEORZLX-UHFFFAOYSA-M
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride is a white crystalline solid with a molecular weight...

Compound Q&A

How is 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6) typically synthesized?

1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride is typically synthesized through a multi-step proces...

Compound Q&A

What precautions should be taken when handling 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride (CAS: 70862-65-6)?

When handling 1,3-Didecyl-2-methyl-1H-imidazol-3-ium chloride, it is important to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...