Compound Q&A

What industries use 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5)?

Answer

4-(3-Oxo-4-morpholinyl)benzoic acid
4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5) is used in the pharmaceutical industry for the synthesis of drug intermediates and in the polymer industry as a monomer. It also finds applications in the sensor technology and semiconductor sectors due to its unique chemical properties.

About

English Name 4-(3-Oxo-4-morpholinyl)benzoic acid
Molecular Formula C11H11NO4
Molecular Weight 221.21 g/mol
SMILES C1COCC(=O)N1C2=CC=C(C=C2)C(=O)O
InChIKey HUZZDKHRFFOLQU-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5)?

4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5) is a crystalline solid with a molecular weigh...

Compound Q&A

How is 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5) typically synthesized?

4-(3-Oxo-4-morpholinyl)benzoic acid is typically synthesized through the condensation of 4-morpholin...

Compound Q&A

What precautions should be taken when handling 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5)?

When handling 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...