Compound Q&A

What are the physical and chemical properties of 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5)?

Answer

4-(3-Oxo-4-morpholinyl)benzoic acid
4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5) is a crystalline solid with a molecular weight of approximately 237.3 g/mol. It has a limited water solubility and is slightly soluble in common organic solvents like ethanol and acetone. The compound is known for its low reactivity under typical laboratory conditions but can undergo ring-opening reactions under strong basic conditions. It is stable under neutral and acidic conditions.

About

English Name 4-(3-Oxo-4-morpholinyl)benzoic acid
Molecular Formula C11H11NO4
Molecular Weight 221.21 g/mol
SMILES C1COCC(=O)N1C2=CC=C(C=C2)C(=O)O
InChIKey HUZZDKHRFFOLQU-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5) typically synthesized?

4-(3-Oxo-4-morpholinyl)benzoic acid is typically synthesized through the condensation of 4-morpholin...

Compound Q&A

What industries use 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5)?

4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5) is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5)?

When handling 4-(3-Oxo-4-morpholinyl)benzoic acid (CAS: 720720-60-5), it is important to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...