Compound Q&A

What industries use 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

Answer

2,6,7-Trichloroquinoxaline
2,6,7-Trichloroquinoxaline is used in the pharmaceutical, polymer, and sensor industries. It serves as a precursor in the synthesis of certain pharmaceutical compounds and can be utilized in the development of polymers and sensors due to its unique electronic and chemical properties.

About

CAS No 41213-31-4
English Name 2,6,7-Trichloroquinoxaline
Molecular Formula C8H3Cl3N2
Molecular Weight 233.48 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)N=C(C=N2)Cl
InChIKey WKHZLRADDUHIIV-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

2,6,7-Trichloroquinoxaline is a crystalline solid with a molecular weight of approximately 249.02 g/...

Compound Q&A

How is 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4) typically synthesized?

2,6,7-Trichloroquinoxaline can be synthesized via a multistep reaction involving the chlorination of...

Compound Q&A

What precautions should be taken when handling 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

When handling 2,6,7-Trichloroquinoxaline, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...