Compound Q&A

What are the physical and chemical properties of 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

Answer

2,6,7-Trichloroquinoxaline
2,6,7-Trichloroquinoxaline is a crystalline solid with a molecular weight of approximately 249.02 g/mol. It has a melting point of around 192-194°C and is practically insoluble in water but soluble in organic solvents like ethanol and acetone. It is relatively stable under normal conditions but can react with certain reagents and form complexes.

About

CAS No 41213-31-4
English Name 2,6,7-Trichloroquinoxaline
Molecular Formula C8H3Cl3N2
Molecular Weight 233.48 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)N=C(C=N2)Cl
InChIKey WKHZLRADDUHIIV-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4) typically synthesized?

2,6,7-Trichloroquinoxaline can be synthesized via a multistep reaction involving the chlorination of...

Compound Q&A

What industries use 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

2,6,7-Trichloroquinoxaline is used in the pharmaceutical, polymer, and sensor industries. It serves ...

Compound Q&A

What precautions should be taken when handling 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

When handling 2,6,7-Trichloroquinoxaline, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...