Compound Q&A

How is 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4) typically synthesized?

Answer

2,6,7-Trichloroquinoxaline
2,6,7-Trichloroquinoxaline can be synthesized via a multistep reaction involving the chlorination of quinoxaline derivatives. Commonly, the reaction involves chlorination of quinoxaline with thionyl chloride in an appropriate solvent. The yield is typically around 80%, and the purity can be enhanced through recrystallization.

About

CAS No 41213-31-4
English Name 2,6,7-Trichloroquinoxaline
Molecular Formula C8H3Cl3N2
Molecular Weight 233.48 g/mol
SMILES C1=C2C(=CC(=C1Cl)Cl)N=C(C=N2)Cl
InChIKey WKHZLRADDUHIIV-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

2,6,7-Trichloroquinoxaline is a crystalline solid with a molecular weight of approximately 249.02 g/...

Compound Q&A

What industries use 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

2,6,7-Trichloroquinoxaline is used in the pharmaceutical, polymer, and sensor industries. It serves ...

Compound Q&A

What precautions should be taken when handling 2,6,7-Trichloroquinoxaline (CAS: 41213-31-4)?

When handling 2,6,7-Trichloroquinoxaline, it is essential to wear appropriate personal protective eq...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...