Compound Q&A

What industries use 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

Answer

2,2-Dibromo-1-(2-chlorophenyl)ethanone
2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) finds applications in pharmaceuticals, where it is used as an intermediate in the synthesis of various drugs. It is also utilized in the polymer industry for modifying polymer properties and in the production of sensors. Additionally, it can be used in the semiconductor industry as a precursor in certain chemical vapor deposition processes.

About

CAS No 34356-83-7
English Name 2,2-Dibromo-1-(2-chlorophenyl)ethanone
Molecular Formula C8H5Br2ClO
Molecular Weight 312.388 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(Br)Br)Cl
InChIKey ZIJBOKNENCASCS-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is a crystalline solid with a molecular wei...

Compound Q&A

How is 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) typically synthesized?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is synthesized via nucleophilic substitutio...

Compound Q&A

What precautions should be taken when handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

When handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7), it is crucial to use appropr...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...