Compound Q&A

What are the physical and chemical properties of 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

Answer

2,2-Dibromo-1-(2-chlorophenyl)ethanone
2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is a crystalline solid with a molecular weight of approximately 311.04 g/mol. It has limited water solubility and is highly reactive due to its bromine and chlorine functionalities. This compound is insoluble in water but soluble in organic solvents such as dichloromethane and acetonitrile. It is prone to hydrolysis and is an effective electrophilic reagent.

About

CAS No 34356-83-7
English Name 2,2-Dibromo-1-(2-chlorophenyl)ethanone
Molecular Formula C8H5Br2ClO
Molecular Weight 312.388 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(Br)Br)Cl
InChIKey ZIJBOKNENCASCS-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

How is 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) typically synthesized?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is synthesized via nucleophilic substitutio...

Compound Q&A

What industries use 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) finds applications in pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

When handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7), it is crucial to use appropr...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...