Compound Q&A

How is 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) typically synthesized?

Answer

2,2-Dibromo-1-(2-chlorophenyl)ethanone
2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is synthesized via nucleophilic substitution reactions. Common methods involve the bromination of 1-(2-chlorophenyl)ethanone using bromine in the presence of a catalyst. The reaction is typically carried out in an organic solvent, and the product is purified by recrystallization from an appropriate solvent to achieve high purity.

About

CAS No 34356-83-7
English Name 2,2-Dibromo-1-(2-chlorophenyl)ethanone
Molecular Formula C8H5Br2ClO
Molecular Weight 312.39 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(Br)Br)Cl
InChIKey ZIJBOKNENCASCS-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) finds applications in pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

When handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7), it is crucial to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...