Compound Q&A

How is 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) typically synthesized?

Answer

2,2-Dibromo-1-(2-chlorophenyl)ethanone
2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is synthesized via nucleophilic substitution reactions. Common methods involve the bromination of 1-(2-chlorophenyl)ethanone using bromine in the presence of a catalyst. The reaction is typically carried out in an organic solvent, and the product is purified by recrystallization from an appropriate solvent to achieve high purity.

About

CAS No 34356-83-7
English Name 2,2-Dibromo-1-(2-chlorophenyl)ethanone
Molecular Formula C8H5Br2ClO
Molecular Weight 312.388 g/mol
SMILES C1=CC=C(C(=C1)C(=O)C(Br)Br)Cl
InChIKey ZIJBOKNENCASCS-UHFFFAOYSA-N
Last Updated: 2026-03-17 06:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) is a crystalline solid with a molecular wei...

Compound Q&A

What industries use 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7) finds applications in pharmaceuticals, wher...

Compound Q&A

What precautions should be taken when handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7)?

When handling 2,2-Dibromo-1-(2-chlorophenyl)ethanone (CAS: 34356-83-7), it is crucial to use appropr...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...