Compound Q&A

What industries use Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

Answer

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is used in the pharmaceutical industry for the synthesis of various bioactive molecules. It also finds applications in the polymer industry for the development of advanced materials. Additionally, it is used in the production of sensors and devices for semiconductor fabrication.

About

CAS No 78979-63-2
English Name Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Molecular Formula C12H10N2O5
Molecular Weight 262.22 g/mol
SMILES CCOC(=O)C1=COC(=N1)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey JNLOOVCJFBYWCV-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is a crystalline compound with a molecular weight ...

Compound Q&A

How is Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2) typically synthesized?

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is typically synthesized via the condensation of 4...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

When handling Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...