Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

Answer

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is a crystalline compound with a molecular weight of approximately 264.22 g/mol. It has a melting point around 175-178°C. The compound is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. It is chemically reactive, particularly towards nucleophiles and reducing agents.

About

CAS No 78979-63-2
English Name Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Molecular Formula C12H10N2O5
Molecular Weight 262.22 g/mol
SMILES CCOC(=O)C1=COC(=N1)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey JNLOOVCJFBYWCV-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

How is Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2) typically synthesized?

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is typically synthesized via the condensation of 4...

Compound Q&A

What industries use Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

When handling Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...