Compound Q&A

How is Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2) typically synthesized?

Answer

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is typically synthesized via the condensation of 4-nitrobenzaldehyde with ethyl 1,3-oxazole-4-carboxylate using a suitable base like sodium hydroxide. The reaction is carried out in a polar aprotic solvent such as dimethylformamide. The yield is usually around 75-85%, with high stereochemical purity.

About

CAS No 78979-63-2
English Name Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate
Molecular Formula C12H10N2O5
Molecular Weight 262.22 g/mol
SMILES CCOC(=O)C1=COC(=N1)C2=CC=C(C=C2)[N+](=O)[O-]
InChIKey JNLOOVCJFBYWCV-UHFFFAOYSA-N
Last Updated: 2026-03-17 01:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is a crystalline compound with a molecular weight ...

Compound Q&A

What industries use Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate is used in the pharmaceutical industry for the syn...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate (CAS: 78979-63-2)?

When handling Ethyl 2-(4-nitrophenyl)-1,3-oxazole-4-carboxylate, it is essential to use personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...