Compound Q&A

What precautions should be taken when handling 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

Answer

4-(Dimethylamino)benzenecarboximidamide dihydrochloride
When handling 4-(Dimethylamino)benzenecarboximidamide dihydrochloride, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and lab coats. Work in a fume hood to minimize inhalation risks. Spills should be cleaned up with appropriate absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for specific handling and disposal guidelines.

About

English Name 4-(Dimethylamino)benzenecarboximidamide dihydrochloride
Molecular Formula C9H15Cl2N3
Molecular Weight 199.69 g/mol
SMILES CN(C)C1=CC=C(C=C1)C(=N)N.Cl
InChIKey QVWJLPLJSLCQMX-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride is a white crystalline solid with a molecula...

Compound Q&A

How is 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6) typically synthesized?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride is typically synthesized through a multi-ste...

Compound Q&A

What industries use 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride finds applications in various industries inc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...