Compound Q&A

What are the physical and chemical properties of 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

Answer

4-(Dimethylamino)benzenecarboximidamide dihydrochloride
4-(Dimethylamino)benzenecarboximidamide dihydrochloride is a white crystalline solid with a molecular weight of approximately 283.85 g/mol. It is soluble in water and organic solvents. The compound exhibits good stability under normal conditions but may react with strong bases. It is highly soluble in common organic solvents such as methanol and ethanol.

About

English Name 4-(Dimethylamino)benzenecarboximidamide dihydrochloride
Molecular Formula C9H15Cl2N3
Molecular Weight 199.69 g/mol
SMILES CN(C)C1=CC=C(C=C1)C(=N)N.Cl
InChIKey QVWJLPLJSLCQMX-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6) typically synthesized?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride is typically synthesized through a multi-ste...

Compound Q&A

What industries use 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride finds applications in various industries inc...

Compound Q&A

What precautions should be taken when handling 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

When handling 4-(Dimethylamino)benzenecarboximidamide dihydrochloride, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...