Compound Q&A

How is 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6) typically synthesized?

Answer

4-(Dimethylamino)benzenecarboximidamide dihydrochloride
4-(Dimethylamino)benzenecarboximidamide dihydrochloride is typically synthesized through a multi-step process involving the reaction of 4-(dimethylamino)benzenecarboxylic acid with carbonyl diimidazole followed by hydrochlorination. The synthesis involves the use of imidazole as a catalyst and requires careful handling to achieve high selectivity and yield.

About

English Name 4-(Dimethylamino)benzenecarboximidamide dihydrochloride
Molecular Formula C9H15Cl2N3
Molecular Weight 199.69 g/mol
SMILES CN(C)C1=CC=C(C=C1)C(=N)N.Cl
InChIKey QVWJLPLJSLCQMX-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride is a white crystalline solid with a molecula...

Compound Q&A

What industries use 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

4-(Dimethylamino)benzenecarboximidamide dihydrochloride finds applications in various industries inc...

Compound Q&A

What precautions should be taken when handling 4-(Dimethylamino)benzenecarboximidamide dihydrochloride (CAS: 180507-22-6)?

When handling 4-(Dimethylamino)benzenecarboximidamide dihydrochloride, it is essential to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...