Compound Q&A

How is Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) typically synthesized?

Answer

Ethyl 2-(2-bromo-5-fluorophenyl)acetate
Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is typically synthesized via a bromination reaction of 2-(5-fluorophenyl)acetic acid with bromine in the presence of a phase transfer catalyst. The reaction is highly selective and provides a high yield of the desired product. Common conditions involve using a solvent like dichloromethane and a base such as triethylamine.

About

English Name Ethyl 2-(2-bromo-5-fluorophenyl)acetate
Molecular Formula C10H10BrFO2
Molecular Weight 261.09 g/mol
SMILES CCOC(=O)CC1=C(C=CC(=C1)F)Br
InChIKey VJIZBDVPORTFJC-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is a colorless to slightly yellow liquid...

Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

When handling Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8), proper personal protectiv...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...