Compound Q&A

What are the physical and chemical properties of Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Answer

Ethyl 2-(2-bromo-5-fluorophenyl)acetate
Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is a colorless to slightly yellow liquid with a molecular weight of approximately 315.03 g/mol. It has a moderate solubility in common organic solvents like ethanol and acetone but is poorly soluble in water. This compound is moderately reactive, with potential for bromide and fluoride ion exchange. It is often used in organic synthesis due to its reactivity and specific functional groups.

About

English Name Ethyl 2-(2-bromo-5-fluorophenyl)acetate
Molecular Formula C10H10BrFO2
Molecular Weight 261.09 g/mol
SMILES CCOC(=O)CC1=C(C=CC(=C1)F)Br
InChIKey VJIZBDVPORTFJC-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) typically synthesized?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is typically synthesized via a brominati...

Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

When handling Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8), proper personal protectiv...

Compound Q&A

How should waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) be handled?

Waste containing 4-Bromo-3-methyl-2-thiophenecarboxylic acid (CAS: 265652-39-9) ...

265652-39-94-Bromo-3-methyl-2-t...
Compound Q&A

What industries use (2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) (CAS: 136779-26-5)?

(2S,5S,2'S,5'S)-1,1'-(1,2-Ethanediyl)bis(2,5-dimethylphospholane) is primarily u...

136779-26-5(2S,5S,2'S,5'S)-1,1'...
Compound Q&A

What industries use Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8)?

Ethyl 2-(2-bromo-5-fluorophenyl)acetate (CAS: 1214910-61-8) is used in the pharm...

1214910-61-8Ethyl 2-(2-bromo-5-f...
Compound Q&A

How is 4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) typically synthesized?

4-Methyl-2-benzofuran-1,3-dione (CAS: 4792-30-7) can be synthesized through seve...

4792-30-74-Methyl-2-benzofura...