Compound Q&A

What industries use 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

Answer

4-(Ethylamino)-3-nitrobenzoic acid
4-(Ethylamino)-3-nitrobenzoic acid finds applications in the pharmaceutical industry as an intermediate in the synthesis of certain drugs. It is also used in the polymer industry for the modification of polymer properties and in the development of sensors due to its spectroscopic and electrochemical properties. Additionally, it is explored in the semiconductor industry for its potential use in organic semiconductor materials.

About

CAS No 2788-74-1
English Name 4-(Ethylamino)-3-nitrobenzoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES CCNc1ccc(cc1[N+](=O)[O-])C(=O)O
InChIKey XPLTXYDVYDWSSO-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

4-(Ethylamino)-3-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

How is 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1) typically synthesized?

4-(Ethylamino)-3-nitrobenzoic acid can be synthesized via the amination of 3-nitrobenzoic acid with ...

Compound Q&A

What precautions should be taken when handling 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

Handling 4-(Ethylamino)-3-nitrobenzoic acid requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...