Compound Q&A

How is 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1) typically synthesized?

Answer

4-(Ethylamino)-3-nitrobenzoic acid
4-(Ethylamino)-3-nitrobenzoic acid can be synthesized via the amination of 3-nitrobenzoic acid with ethylamine followed by a coupling reaction. Commonly, the synthesis involves the nitro group being reduced to an amino group using hydrazine or sodium borohydride, followed by the amination step. The reaction typically provides a yield of 70-80%, and the process requires mild conditions to prevent decomposition.

About

CAS No 2788-74-1
English Name 4-(Ethylamino)-3-nitrobenzoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES CCNc1ccc(cc1[N+](=O)[O-])C(=O)O
InChIKey XPLTXYDVYDWSSO-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

4-(Ethylamino)-3-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 2...

Compound Q&A

What industries use 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

4-(Ethylamino)-3-nitrobenzoic acid finds applications in the pharmaceutical industry as an intermedi...

Compound Q&A

What precautions should be taken when handling 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

Handling 4-(Ethylamino)-3-nitrobenzoic acid requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...