Compound Q&A

What are the physical and chemical properties of 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

Answer

4-(Ethylamino)-3-nitrobenzoic acid
4-(Ethylamino)-3-nitrobenzoic acid is a crystalline solid with a molecular weight of approximately 238.15 g/mol. It has a low solubility in water (2.6 g/L at 20°C) but good solubility in organic solvents like methanol and ethanol. The compound is moderately reactive, particularly towards reducing agents and bases. It can form complexes with metals and exhibits color changes in certain acidic or basic solutions.

About

CAS No 2788-74-1
English Name 4-(Ethylamino)-3-nitrobenzoic acid
Molecular Formula C9H10N2O4
Molecular Weight 210.19 g/mol
SMILES CCNc1ccc(cc1[N+](=O)[O-])C(=O)O
InChIKey XPLTXYDVYDWSSO-UHFFFAOYSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1) typically synthesized?

4-(Ethylamino)-3-nitrobenzoic acid can be synthesized via the amination of 3-nitrobenzoic acid with ...

Compound Q&A

What industries use 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

4-(Ethylamino)-3-nitrobenzoic acid finds applications in the pharmaceutical industry as an intermedi...

Compound Q&A

What precautions should be taken when handling 4-(Ethylamino)-3-nitrobenzoic acid (CAS: 2788-74-1)?

Handling 4-(Ethylamino)-3-nitrobenzoic acid requires appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...