Compound Q&A

What precautions should be taken when handling Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2)?

Answer

Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)-
When handling this compound, it is essential to use proper personal protective equipment (PPE) such as gloves and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure to potential vapors. Spills should be managed according to standard procedures, and the Safety Data Sheet (SDS) should be consulted for specific disposal and emergency response guidelines.

About

English Name Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)-
Molecular Formula C15H18O3
Molecular Weight 246.3 g/mol
SMILES CC1=C(C2=C(C3(CC3)C(C(=O)C2=C1)(C)O)C)CO
InChIKey NICJCIQSJJKZAH-AWEZNQCLSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

What are the physical and chemical properties of Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2)?

This compound is a crystalline solid with a molecular weight of approximately 268.39 g/mol. It has a...

Compound Q&A

How is Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2) typically synthesized?

The compound is often synthesized via a multistep process involving the formation of the spiro cyclo...

Compound Q&A

What industries use Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2)?

This compound is used in the pharmaceutical industry for the development of new drugs due to its uni...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...