Compound Q&A

What are the physical and chemical properties of Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2)?

Answer

Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)-
This compound is a crystalline solid with a molecular weight of approximately 268.39 g/mol. It has a low solubility in water but is more soluble in organic solvents like dichloromethane and acetone. Chemically, it is reactive towards nucleophiles and can undergo various transformations such as esterification and reduction. It features a spiro cyclopropane ring fused to an indene ring with hydroxyl and hydroxymethyl substituents.

About

English Name Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)-
Molecular Formula C15H18O3
Molecular Weight 246.3 g/mol
SMILES CC1=C(C2=C(C3(CC3)C(C(=O)C2=C1)(C)O)C)CO
InChIKey NICJCIQSJJKZAH-AWEZNQCLSA-N
Last Updated: 2026-03-16 21:46

Related Q&A

Compound Q&A

How is Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2) typically synthesized?

The compound is often synthesized via a multistep process involving the formation of the spiro cyclo...

Compound Q&A

What industries use Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2)?

This compound is used in the pharmaceutical industry for the development of new drugs due to its uni...

Compound Q&A

What precautions should be taken when handling Spiro[cyclopropane-1,5'-[5H]inden]-7'(6'H)-one, 6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethyl-, (6'R)- (CAS: 158440-71-2)?

When handling this compound, it is essential to use proper personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...