Compound Q&A

What industries use Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

Answer

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate
Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is used in the pharmaceutical industry for the synthesis of certain drugs. It is also explored in the polymer industry for the development of new materials with specific properties. Additionally, it has potential applications in sensor technology and semiconductor production due to its functional groups, which can be utilized for surface modifications and functionalization.

About

English Name Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate
Molecular Formula C9H12N2O4
Molecular Weight 212.2 g/mol
SMILES CC(CC(=O)OC)C1=C(N=CNC1=O)O
InChIKey XLADYKVTZFVWDT-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is a crystalline compound with a...

Compound Q&A

How is Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) typically synthesized?

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is typically synthesized via a m...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

When handling Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...