Compound Q&A

What are the physical and chemical properties of Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

Answer

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate
Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is a crystalline compound with a molecular weight of approximately 214.2 g/mol. It has a low water solubility and is slightly soluble in organic solvents like ethanol and acetone. Chemically, it exhibits good reactivity due to the presence of hydroxyl groups, making it suitable for various chemical reactions. It is stable under acidic and neutral conditions but may degrade under basic conditions.

About

English Name Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate
Molecular Formula C9H12N2O4
Molecular Weight 212.2 g/mol
SMILES CC(CC(=O)OC)C1=C(N=CNC1=O)O
InChIKey XLADYKVTZFVWDT-UHFFFAOYSA-N
Last Updated: 2026-03-16 17:23

Related Q&A

Compound Q&A

How is Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) typically synthesized?

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is typically synthesized via a m...

Compound Q&A

What industries use Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6) is used in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6)?

When handling Methyl 3-(4,6-dihydroxypyrimidin-5-yl)butanoate (CAS: 1092460-40-6), it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...